C20H24ClNO4 — CID 138492066
(6E,10E)-15-chloro-16,18-dihydroxy-12-imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 138492066) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is (6E,10E)-15-chloro-16,18-dihydroxy-12-imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E)-15-chloro-16,18-dihydroxy-12-imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 138492066 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (6E,10E)-15-chloro-16,18-dihydroxy-12-imino-4-propyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | [H]/N=C1\C=C\CC/C=C/CC(CCC)OC(=O)c2c(O)cc(O)c(Cl)c2C1 |
| InChI | InChI=1S/C20H24ClNO4/c1-2-8-14-10-7-5-3-4-6-9-13(22)11-15-18(20(25)26-14)16(23)12-17(24)19(15)21/h5-7,9,12,14,22-24H,2-4,8,10-11H2,1H3/b7-5+,9-6+,22-13+ |
| InChIKey | WUUGECZGCQNOOH-OYQGSHCLSA-N |
| XLogP | 4.94 |
| TPSA | 90.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|