C21H25ClO4 — CID 131982488
(4S,6E,10E)-15-chloro-16-hydroxy-18-methyl-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione (PubChem CID 131982488) has the molecular formula C21H25ClO4 and a molecular weight of 376.88 g/mol. Its IUPAC name is (4S,6E,10E)-15-chloro-16-hydroxy-18-methyl-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione.
| Compound Name | (4S,6E,10E)-15-chloro-16-hydroxy-18-methyl-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
|---|---|
| PubChem CID | 131982488 |
| Molecular Formula | C21H25ClO4 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (4S,6E,10E)-15-chloro-16-hydroxy-18-methyl-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
| SMILES | Cc1cc(O)c(Cl)c2c1C(=O)O[C@H](C(C)C)C/C=C/CC/C=C/C(=O)C2 |
| InChI | InChI=1S/C21H25ClO4/c1-13(2)18-10-8-6-4-5-7-9-15(23)12-16-19(21(25)26-18)14(3)11-17(24)20(16)22/h6-9,11,13,18,24H,4-5,10,12H2,1-3H3/b8-6+,9-7+/t18-/m0/s1 |
| InChIKey | PLSSQXCYYLTMKP-KFTALVSSSA-N |
| XLogP | 4.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|