C18H18ClFO7 — CID 143627419
[(6E,10E)-15-chloro-16-hydroperoxy-4-methyl-2,12-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-18-yl]oxy hypofluorite (PubChem CID 143627419) has the molecular formula C18H18ClFO7 and a molecular weight of 400.79 g/mol. Its IUPAC name is [(6E,10E)-15-chloro-16-hydroperoxy-4-methyl-2,12-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-18-yl]oxy hypofluorite.
| Compound Name | [(6E,10E)-15-chloro-16-hydroperoxy-4-methyl-2,12-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-18-yl]oxy hypofluorite |
|---|---|
| PubChem CID | 143627419 |
| Molecular Formula | C18H18ClFO7 |
| Molecular Weight | 400.79 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | [(6E,10E)-15-chloro-16-hydroperoxy-4-methyl-2,12-dioxo-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-18-yl]oxy hypofluorite |
| SMILES | CC1C/C=C/CC/C=C/C(=O)Cc2c(Cl)c(OO)cc(OOF)c2C(=O)O1 |
| InChI | InChI=1S/C18H18ClFO7/c1-11-7-5-3-2-4-6-8-12(21)9-13-16(18(22)24-11)14(26-27-20)10-15(25-23)17(13)19/h3,5-6,8,10-11,23H,2,4,7,9H2,1H3/b5-3+,8-6+ |
| InChIKey | REEZVXLFSNSMSJ-QFXXITGJSA-N |
| XLogP | 4.34 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.79 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|