C26H35ClO7 — CID 91098934
(4S)-15-chloro-16,18-bis(ethoxymethoxy)-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione (PubChem CID 91098934) has the molecular formula C26H35ClO7 and a molecular weight of 495.01 g/mol. Its IUPAC name is (4S)-15-chloro-16,18-bis(ethoxymethoxy)-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione.
| Compound Name | (4S)-15-chloro-16,18-bis(ethoxymethoxy)-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
|---|---|
| PubChem CID | 91098934 |
| Molecular Formula | C26H35ClO7 |
| Molecular Weight | 495.01 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | (4S)-15-chloro-16,18-bis(ethoxymethoxy)-4-propan-2-yl-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaene-2,12-dione |
| SMILES | CCOCOc1cc(OCOCC)c2c(c1Cl)CC(=O)C=CCCC=CC[C@@H](C(C)C)OC2=O |
| InChI | InChI=1S/C26H35ClO7/c1-5-30-16-32-22-15-23(33-17-31-6-2)25(27)20-14-19(28)12-10-8-7-9-11-13-21(18(3)4)34-26(29)24(20)22/h9-12,15,18,21H,5-8,13-14,16-17H2,1-4H3/t21-/m0/s1 |
| InChIKey | VPJJETDZNLXJHW-NRFANRHFSA-N |
| XLogP | 5.67 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.01 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|