C17H19NO4 — CID 121367043
(6E,10E)-16,18-dihydroxy-12-imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 121367043) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (6E,10E)-16,18-dihydroxy-12-imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (6E,10E)-16,18-dihydroxy-12-imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 121367043 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (6E,10E)-16,18-dihydroxy-12-imino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | [H]/N=C1\C=C\CC/C=C/CCOC(=O)c2c(O)cc(O)cc2C1 |
| InChI | InChI=1S/C17H19NO4/c18-13-7-5-3-1-2-4-6-8-22-17(21)16-12(9-13)10-14(19)11-15(16)20/h2,4-5,7,10-11,18-20H,1,3,6,8-9H2/b4-2+,7-5+,18-13+ |
| InChIKey | ZRHRFURIRVSGJR-QDBIDMBMSA-N |
| XLogP | 3.11 |
| TPSA | 90.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|