About 2-[(2R)-oxan-2-yl]phenol
2-[(2R)-oxan-2-yl]phenol (PubChem CID 92978074) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-[(2R)-oxan-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[(2R)-oxan-2-yl]phenol |
| PubChem CID | 92978074 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-[(2R)-oxan-2-yl]phenol |
| SMILES | Oc1ccccc1[C@H]1CCCCO1 |
| InChI | InChI=1S/C11H14O2/c12-10-6-2-1-5-9(10)11-7-3-4-8-13-11/h1-2,5-6,11-12H,3-4,7-8H2/t11-/m1/s1 |
| InChIKey | QTVJJZSEFNGOES-LLVKDONJSA-N |
| XLogP | 2.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2R)-oxan-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-oxan-2-yl]phenol?
The IUPAC name of 2-[(2R)-oxan-2-yl]phenol (CID 92978074) is 2-[(2R)-oxan-2-yl]phenol.
What is the SMILES notation for 2-[(2R)-oxan-2-yl]phenol?
The canonical SMILES for 2-[(2R)-oxan-2-yl]phenol is Oc1ccccc1[C@H]1CCCCO1.
What is the InChIKey of 2-[(2R)-oxan-2-yl]phenol?
The InChIKey is QTVJJZSEFNGOES-LLVKDONJSA-N. The full InChI is InChI=1S/C11H14O2/c12-10-6-2-1-5-9(10)11-7-3-4-8-13-11/h1-2,5-6,11-12H,3-4,7-8H2/t11-/m1/s1.
What are the key properties of 2-[(2R)-oxan-2-yl]phenol?
2-[(2R)-oxan-2-yl]phenol has a molecular weight of 178.23 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-oxan-2-yl]phenol is sourced from PubChem (CID 92978074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).