About [2-(oxan-2-yl)phenyl] methanesulfonate
[2-(oxan-2-yl)phenyl] methanesulfonate (PubChem CID 166653039) has the molecular formula C12H16O4S
and a molecular weight of 256.32 g/mol. Its IUPAC name is [2-(oxan-2-yl)phenyl] methanesulfonate.
Molecular Properties
| Compound Name | [2-(oxan-2-yl)phenyl] methanesulfonate |
| PubChem CID | 166653039 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [2-(oxan-2-yl)phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccccc1C1CCCCO1 |
| InChI | InChI=1S/C12H16O4S/c1-17(13,14)16-12-8-3-2-6-10(12)11-7-4-5-9-15-11/h2-3,6,8,11H,4-5,7,9H2,1H3 |
| InChIKey | GORKFGLXAXHIPV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(oxan-2-yl)phenyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(oxan-2-yl)phenyl] methanesulfonate?
The IUPAC name of [2-(oxan-2-yl)phenyl] methanesulfonate (CID 166653039) is [2-(oxan-2-yl)phenyl] methanesulfonate.
What is the SMILES notation for [2-(oxan-2-yl)phenyl] methanesulfonate?
The canonical SMILES for [2-(oxan-2-yl)phenyl] methanesulfonate is CS(=O)(=O)Oc1ccccc1C1CCCCO1.
What is the InChIKey of [2-(oxan-2-yl)phenyl] methanesulfonate?
The InChIKey is GORKFGLXAXHIPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4S/c1-17(13,14)16-12-8-3-2-6-10(12)11-7-4-5-9-15-11/h2-3,6,8,11H,4-5,7,9H2,1H3.
What are the key properties of [2-(oxan-2-yl)phenyl] methanesulfonate?
[2-(oxan-2-yl)phenyl] methanesulfonate has a molecular weight of 256.32 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(oxan-2-yl)phenyl] methanesulfonate is sourced from PubChem (CID 166653039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).