C15H24N2O3S — CID 174525956
[2-(aminomethyl)-3-(1-ethylpiperidin-4-yl)phenyl] methanesulfonate (PubChem CID 174525956) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is [2-(aminomethyl)-3-(1-ethylpiperidin-4-yl)phenyl] methanesulfonate.
| Compound Name | [2-(aminomethyl)-3-(1-ethylpiperidin-4-yl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 174525956 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [2-(aminomethyl)-3-(1-ethylpiperidin-4-yl)phenyl] methanesulfonate |
| SMILES | CCN1CCC(c2cccc(OS(C)(=O)=O)c2CN)CC1 |
| InChI | InChI=1S/C15H24N2O3S/c1-3-17-9-7-12(8-10-17)13-5-4-6-15(14(13)11-16)20-21(2,18)19/h4-6,12H,3,7-11,16H2,1-2H3 |
| InChIKey | ULWZVGIVUKPAAS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|