C20H22ClNO8 — CID 72606687
16-chloro-13-(2,2-dihydroxyethoxyimino)-17,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one (PubChem CID 72606687) has the molecular formula C20H22ClNO8 and a molecular weight of 439.85 g/mol. Its IUPAC name is 16-chloro-13-(2,2-dihydroxyethoxyimino)-17,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one.
| Compound Name | 16-chloro-13-(2,2-dihydroxyethoxyimino)-17,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one |
|---|---|
| PubChem CID | 72606687 |
| Molecular Formula | C20H22ClNO8 |
| Molecular Weight | 439.85 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 16-chloro-13-(2,2-dihydroxyethoxyimino)-17,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one |
| SMILES | CC1CC2OC2C=CC=CC(=NOCC(O)O)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C20H22ClNO8/c1-10-6-16-15(30-16)5-3-2-4-11(22-28-9-17(25)26)7-12-18(20(27)29-10)13(23)8-14(24)19(12)21/h2-5,8,10,15-17,23-26H,6-7,9H2,1H3 |
| InChIKey | CUQOGGBENDKGML-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.85 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|