C20H21ClFNO6 — CID 161456444
(4R,6R,8R,9Z,11E)-16-chloro-13-(2-fluoroethoxyimino)-17,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one (PubChem CID 161456444) has the molecular formula C20H21ClFNO6 and a molecular weight of 425.84 g/mol. Its IUPAC name is (4R,6R,8R,9Z,11E)-16-chloro-13-(2-fluoroethoxyimino)-17,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one.
| Compound Name | (4R,6R,8R,9Z,11E)-16-chloro-13-(2-fluoroethoxyimino)-17,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one |
|---|---|
| PubChem CID | 161456444 |
| Molecular Formula | C20H21ClFNO6 |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | (4R,6R,8R,9Z,11E)-16-chloro-13-(2-fluoroethoxyimino)-17,19-dihydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-2-one |
| SMILES | C[C@@H]1C[C@H]2O[C@@H]2/C=C/C=C/C(=NOCCF)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C20H21ClFNO6/c1-11-8-17-16(29-17)5-3-2-4-12(23-27-7-6-22)9-13-18(20(26)28-11)14(24)10-15(25)19(13)21/h2-5,10-11,16-17,24-25H,6-9H2,1H3/b4-2+,5-3+,23-12?/t11-,16-,17-/m1/s1 |
| InChIKey | WBFHMAFHYJSERV-TULZDJBQSA-N |
| XLogP | 3.46 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|