C24H27ClN2O7 — CID 101157355
1-[2-[(Z)-[(4R,6R,8R,9Z,11Z)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]pyrrolidin-2-one (PubChem CID 101157355) has the molecular formula C24H27ClN2O7 and a molecular weight of 490.94 g/mol. Its IUPAC name is 1-[2-[(Z)-[(4R,6R,8R,9Z,11Z)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[(Z)-[(4R,6R,8R,9Z,11Z)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 101157355 |
| Molecular Formula | C24H27ClN2O7 |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 1-[2-[(Z)-[(4R,6R,8R,9Z,11Z)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]pyrrolidin-2-one |
| SMILES | C[C@@H]1C[C@H]2O[C@@H]2/C=C\C=C/C(=N\OCCN2CCCC2=O)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C24H27ClN2O7/c1-14-11-20-19(34-20)6-3-2-5-15(26-32-10-9-27-8-4-7-21(27)30)12-16-22(24(31)33-14)17(28)13-18(29)23(16)25/h2-3,5-6,13-14,19-20,28-29H,4,7-12H2,1H3/b5-2-,6-3-,26-15+/t14-,19-,20-/m1/s1 |
| InChIKey | XVHHDHWPBRTNET-SOTVZLCNSA-N |
| XLogP | 3.12 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|