C25H29ClN2O6 — CID 123913576
1-[2-[[(4R,6R,8R)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-7-oxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]pyrrolidin-2-one (PubChem CID 123913576) has the molecular formula C25H29ClN2O6 and a molecular weight of 488.97 g/mol. Its IUPAC name is 1-[2-[[(4R,6R,8R)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-7-oxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[[(4R,6R,8R)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-7-oxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123913576 |
| Molecular Formula | C25H29ClN2O6 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 1-[2-[[(4R,6R,8R)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-7-oxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]pyrrolidin-2-one |
| SMILES | C[C@H]1CC(=O)c2c(O)cc(O)c(Cl)c2CC(=NOCCN2CCCC2=O)C=CC=C[C@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C25H29ClN2O6/c1-15-11-18(29)24-17(25(26)20(31)14-19(24)30)13-16(5-2-3-6-21-22(12-15)34-21)27-33-10-9-28-8-4-7-23(28)32/h2-3,5-6,14-15,21-22,30-31H,4,7-13H2,1H3/t15-,21+,22+/m0/s1 |
| InChIKey | MIQKHJXTQGNKOY-ITEAAPOESA-N |
| XLogP | 3.78 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|