C24H26ClN3O8 — CID 23375974
3-[2-[(Z)-[(9E,11E)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]-1-methylimidazolidine-2,4-dione (PubChem CID 23375974) has the molecular formula C24H26ClN3O8 and a molecular weight of 519.94 g/mol. Its IUPAC name is 3-[2-[(Z)-[(9E,11E)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(Z)-[(9E,11E)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 23375974 |
| Molecular Formula | C24H26ClN3O8 |
| Molecular Weight | 519.94 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 3-[2-[(Z)-[(9E,11E)-16-chloro-17,19-dihydroxy-4-methyl-2-oxo-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaen-13-ylidene]amino]oxyethyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CC1CC2OC2/C=C/C=C/C(=N\OCCN2C(=O)CN(C)C2=O)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C24H26ClN3O8/c1-13-9-19-18(36-19)6-4-3-5-14(26-34-8-7-28-20(31)12-27(2)24(28)33)10-15-21(23(32)35-13)16(29)11-17(30)22(15)25/h3-6,11,13,18-19,29-30H,7-10,12H2,1-2H3/b5-3+,6-4+,26-14+ |
| InChIKey | MZZDZSYEUNTHIQ-XFHYNHMSSA-N |
| XLogP | 2.39 |
| TPSA | 141.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.94 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|