C28H39N3O6 — CID 129281375
(4R,6E,8S,10E)-8-amino-16,18-dihydroxy-12-imino-4-methyl-15-[1-(2-oxo-2-piperidin-1-ylethoxy)propan-2-yl]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 129281375) has the molecular formula C28H39N3O6 and a molecular weight of 513.64 g/mol. Its IUPAC name is (4R,6E,8S,10E)-8-amino-16,18-dihydroxy-12-imino-4-methyl-15-[1-(2-oxo-2-piperidin-1-ylethoxy)propan-2-yl]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (4R,6E,8S,10E)-8-amino-16,18-dihydroxy-12-imino-4-methyl-15-[1-(2-oxo-2-piperidin-1-ylethoxy)propan-2-yl]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 129281375 |
| Molecular Formula | C28H39N3O6 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (4R,6E,8S,10E)-8-amino-16,18-dihydroxy-12-imino-4-methyl-15-[1-(2-oxo-2-piperidin-1-ylethoxy)propan-2-yl]-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | [H]/N=C1\C=C\C[C@H](N)/C=C/C[C@@H](C)OC(=O)c2c(O)cc(O)c(C(C)COCC(=O)N3CCCCC3)c2C1 |
| InChI | InChI=1S/C28H39N3O6/c1-18(16-36-17-25(34)31-12-4-3-5-13-31)26-22-14-21(30)11-7-10-20(29)9-6-8-19(2)37-28(35)27(22)24(33)15-23(26)32/h6-7,9,11,15,18-20,30,32-33H,3-5,8,10,12-14,16-17,29H2,1-2H3/b9-6+,11-7+,30-21+/t18?,19-,20-/m1/s1 |
| InChIKey | PZYQTTMJNGIHHP-IQTHALQWSA-N |
| XLogP | 3.57 |
| TPSA | 146.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|