C17H20O9 — CID 44597574
(4R,5S,6S,8Z,11R)-4,5,6,15,17-pentahydroxy-11-methyl-2,12-dioxabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraene-7,13-dione (PubChem CID 44597574) has the molecular formula C17H20O9 and a molecular weight of 368.34 g/mol. Its IUPAC name is (4R,5S,6S,8Z,11R)-4,5,6,15,17-pentahydroxy-11-methyl-2,12-dioxabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraene-7,13-dione.
| Compound Name | (4R,5S,6S,8Z,11R)-4,5,6,15,17-pentahydroxy-11-methyl-2,12-dioxabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraene-7,13-dione |
|---|---|
| PubChem CID | 44597574 |
| Molecular Formula | C17H20O9 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (4R,5S,6S,8Z,11R)-4,5,6,15,17-pentahydroxy-11-methyl-2,12-dioxabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraene-7,13-dione |
| SMILES | C[C@@H]1C/C=C\C(=O)[C@@H](O)[C@@H](O)[C@H](O)COc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C17H20O9/c1-8-3-2-4-10(19)15(22)16(23)12(21)7-25-13-6-9(18)5-11(20)14(13)17(24)26-8/h2,4-6,8,12,15-16,18,20-23H,3,7H2,1H3/b4-2-/t8-,12-,15-,16+/m1/s1 |
| InChIKey | JKCBHYZOQNPCLU-HPOJCQKCSA-N |
| XLogP | -0.37 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |