C20H24O8 — CID 102087754
(2R,4R,6S,7S,9Z,12S)-6,16-dihydroxy-7,18-dimethoxy-12-methyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,16,18-tetraene-8,14-dione (PubChem CID 102087754) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is (2R,4R,6S,7S,9Z,12S)-6,16-dihydroxy-7,18-dimethoxy-12-methyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,16,18-tetraene-8,14-dione.
| Compound Name | (2R,4R,6S,7S,9Z,12S)-6,16-dihydroxy-7,18-dimethoxy-12-methyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,16,18-tetraene-8,14-dione |
|---|---|
| PubChem CID | 102087754 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (2R,4R,6S,7S,9Z,12S)-6,16-dihydroxy-7,18-dimethoxy-12-methyl-3,13-dioxatricyclo[13.4.0.02,4]nonadeca-1(15),9,16,18-tetraene-8,14-dione |
| SMILES | COc1cc(O)c2c(c1)[C@H]1O[C@@H]1C[C@H](O)[C@H](OC)C(=O)/C=C\C[C@H](C)OC2=O |
| InChI | InChI=1S/C20H24O8/c1-10-5-4-6-13(21)19(26-3)15(23)9-16-18(28-16)12-7-11(25-2)8-14(22)17(12)20(24)27-10/h4,6-8,10,15-16,18-19,22-23H,5,9H2,1-3H3/b6-4-/t10-,15-,16+,18+,19+/m0/s1 |
| InChIKey | FUDIJNCZBYVEHO-BREUNEBNSA-N |
| XLogP | 1.68 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|