C25H31FO8 — CID 91610549
(14S)-11-fluoro-20-methoxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,12,18,20-pentaene-10,16-dione (PubChem CID 91610549) has the molecular formula C25H31FO8 and a molecular weight of 478.51 g/mol. Its IUPAC name is (14S)-11-fluoro-20-methoxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,12,18,20-pentaene-10,16-dione.
| Compound Name | (14S)-11-fluoro-20-methoxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,12,18,20-pentaene-10,16-dione |
|---|---|
| PubChem CID | 91610549 |
| Molecular Formula | C25H31FO8 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (14S)-11-fluoro-20-methoxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,12,18,20-pentaene-10,16-dione |
| SMILES | COCOc1cc(OC)cc2c1C(=O)O[C@@H](C)C(C)=CC(F)C(=O)C1OC(C)(C)OC1CC=C2 |
| InChI | InChI=1S/C25H31FO8/c1-14-10-18(26)22(27)23-19(33-25(3,4)34-23)9-7-8-16-11-17(30-6)12-20(31-13-29-5)21(16)24(28)32-15(14)2/h7-8,10-12,15,18-19,23H,9,13H2,1-6H3/t15-,18?,19?,23?/m0/s1 |
| InChIKey | LECRZEFBFBNDSC-KXYARKMISA-N |
| XLogP | 4.01 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|