C25H32F2O8 — CID 59467074
(2E,5S,9R,11Z,13R,14S)-20-(difluoromethoxy)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one (PubChem CID 59467074) has the molecular formula C25H32F2O8 and a molecular weight of 498.52 g/mol. Its IUPAC name is (2E,5S,9R,11Z,13R,14S)-20-(difluoromethoxy)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one.
| Compound Name | (2E,5S,9R,11Z,13R,14S)-20-(difluoromethoxy)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
|---|---|
| PubChem CID | 59467074 |
| Molecular Formula | C25H32F2O8 |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (2E,5S,9R,11Z,13R,14S)-20-(difluoromethoxy)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
| SMILES | COCOc1cc(OC(F)F)cc2c1C(=O)O[C@@H](C)[C@H](C)/C=C\C(O)[C@H]1OC(C)(C)O[C@H]1C/C=C/2 |
| InChI | InChI=1S/C25H32F2O8/c1-14-9-10-18(28)22-19(34-25(3,4)35-22)8-6-7-16-11-17(33-24(26)27)12-20(31-13-30-5)21(16)23(29)32-15(14)2/h6-7,9-12,14-15,18-19,22,24,28H,8,13H2,1-5H3/b7-6+,10-9-/t14-,15+,18?,19+,22-/m1/s1 |
| InChIKey | GIJZCOVEOQCUCA-XKQQTLBCSA-N |
| XLogP | 4.31 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|