C32H36F2O9 — CID 91116858
[(5S,9S,13R,14S)-20-(difluoromethoxy)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate (PubChem CID 91116858) has the molecular formula C32H36F2O9 and a molecular weight of 602.63 g/mol. Its IUPAC name is [(5S,9S,13R,14S)-20-(difluoromethoxy)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate.
| Compound Name | [(5S,9S,13R,14S)-20-(difluoromethoxy)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate |
|---|---|
| PubChem CID | 91116858 |
| Molecular Formula | C32H36F2O9 |
| Molecular Weight | 602.63 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | [(5S,9S,13R,14S)-20-(difluoromethoxy)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate |
| SMILES | COCOc1cc(OC(F)F)cc2c1C(=O)O[C@@H](C)[C@H](C)C=CC(OC(=O)c1ccccc1)[C@H]1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C32H36F2O9/c1-19-14-15-24(41-29(35)21-10-7-6-8-11-21)28-25(42-32(3,4)43-28)13-9-12-22-16-23(40-31(33)34)17-26(38-18-37-5)27(22)30(36)39-20(19)2/h6-12,14-17,19-20,24-25,28,31H,13,18H2,1-5H3/t19-,20+,24?,25+,28-/m1/s1 |
| InChIKey | DJDJPFMLPDGQNY-KFONQTAPSA-N |
| XLogP | 6.17 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|