C31H37NO8 — CID 173478216
[(5S,9S,11Z,13R)-20-methoxy-18-(methoxymethoxy)-7,7,13-trimethyl-16-oxo-6,8-dioxa-15-azatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate (PubChem CID 173478216) has the molecular formula C31H37NO8 and a molecular weight of 551.64 g/mol. Its IUPAC name is [(5S,9S,11Z,13R)-20-methoxy-18-(methoxymethoxy)-7,7,13-trimethyl-16-oxo-6,8-dioxa-15-azatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate.
| Compound Name | [(5S,9S,11Z,13R)-20-methoxy-18-(methoxymethoxy)-7,7,13-trimethyl-16-oxo-6,8-dioxa-15-azatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate |
|---|---|
| PubChem CID | 173478216 |
| Molecular Formula | C31H37NO8 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | [(5S,9S,11Z,13R)-20-methoxy-18-(methoxymethoxy)-7,7,13-trimethyl-16-oxo-6,8-dioxa-15-azatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate |
| SMILES | COCOc1cc(OC)cc2c1C(=O)NC[C@H](C)/C=C\C(OC(=O)c1ccccc1)[C@H]1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C31H37NO8/c1-20-14-15-24(38-30(34)21-10-7-6-8-11-21)28-25(39-31(2,3)40-28)13-9-12-22-16-23(36-5)17-26(37-19-35-4)27(22)29(33)32-18-20/h6-12,14-17,20,24-25,28H,13,18-19H2,1-5H3,(H,32,33)/b12-9?,15-14-/t20-,24?,25+,28-/m1/s1 |
| InChIKey | PCBAOKSVLADFJM-QHZFGEOWSA-N |
| XLogP | 4.76 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|