C36H48O9Si — CID 173472233
[(5S,9S,11Z,13R,14S)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-20-(2-trimethylsilylethoxy)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate (PubChem CID 173472233) has the molecular formula C36H48O9Si and a molecular weight of 652.86 g/mol. Its IUPAC name is [(5S,9S,11Z,13R,14S)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-20-(2-trimethylsilylethoxy)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate.
| Compound Name | [(5S,9S,11Z,13R,14S)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-20-(2-trimethylsilylethoxy)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate |
|---|---|
| PubChem CID | 173472233 |
| Molecular Formula | C36H48O9Si |
| Molecular Weight | 652.86 g/mol |
| Exact Mass | 652.31 |
| IUPAC Name | [(5S,9S,11Z,13R,14S)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-20-(2-trimethylsilylethoxy)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate |
| SMILES | COCOc1cc(OCC[Si](C)(C)C)cc2c1C(=O)O[C@@H](C)[C@H](C)/C=C\C(OC(=O)c1ccccc1)[C@H]1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C36H48O9Si/c1-24-17-18-29(43-34(37)26-13-10-9-11-14-26)33-30(44-36(3,4)45-33)16-12-15-27-21-28(40-19-20-46(6,7)8)22-31(41-23-39-5)32(27)35(38)42-25(24)2/h9-15,17-18,21-22,24-25,29-30,33H,16,19-20,23H2,1-8H3/b15-12?,18-17-/t24-,25+,29?,30+,33-/m1/s1 |
| InChIKey | RWGWMVDZWDRVGG-UPHJJVHQSA-N |
| XLogP | 7.29 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.86 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|