C32H38O9 — CID 90833514
[(5S,13R,14S)-20-methoxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate (PubChem CID 90833514) has the molecular formula C32H38O9 and a molecular weight of 566.65 g/mol. Its IUPAC name is [(5S,13R,14S)-20-methoxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate.
| Compound Name | [(5S,13R,14S)-20-methoxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate |
|---|---|
| PubChem CID | 90833514 |
| Molecular Formula | C32H38O9 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [(5S,13R,14S)-20-methoxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate |
| SMILES | COCOc1cc(OC)cc2c1C(=O)O[C@@H](C)[C@H](C)C=CC(OC(=O)c1ccccc1)C1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C32H38O9/c1-20-15-16-25(39-30(33)22-11-8-7-9-12-22)29-26(40-32(3,4)41-29)14-10-13-23-17-24(36-6)18-27(37-19-35-5)28(23)31(34)38-21(20)2/h7-13,15-18,20-21,25-26,29H,14,19H2,1-6H3/t20-,21+,25?,26+,29?/m1/s1 |
| InChIKey | HVHZURUUNGFAID-WFIUJZHSSA-N |
| XLogP | 5.58 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|