C33H41NO9 — CID 173470988
[(11Z,13R)-20-(2-aminoethoxy)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate (PubChem CID 173470988) has the molecular formula C33H41NO9 and a molecular weight of 595.69 g/mol. Its IUPAC name is [(11Z,13R)-20-(2-aminoethoxy)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate.
| Compound Name | [(11Z,13R)-20-(2-aminoethoxy)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate |
|---|---|
| PubChem CID | 173470988 |
| Molecular Formula | C33H41NO9 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | [(11Z,13R)-20-(2-aminoethoxy)-18-(methoxymethoxy)-7,7,13,14-tetramethyl-16-oxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-10-yl] benzoate |
| SMILES | COCOc1cc(OCCN)cc2c1C(=O)OC(C)[C@H](C)/C=C\C(OC(=O)c1ccccc1)C1OC(C)(C)OC1CC=C2 |
| InChI | InChI=1S/C33H41NO9/c1-21-14-15-26(41-31(35)23-10-7-6-8-11-23)30-27(42-33(3,4)43-30)13-9-12-24-18-25(38-17-16-34)19-28(39-20-37-5)29(24)32(36)40-22(21)2/h6-12,14-15,18-19,21-22,26-27,30H,13,16-17,20,34H2,1-5H3/b12-9?,15-14-/t21-,22?,26?,27?,30?/m1/s1 |
| InChIKey | UDRPEFDSVCKICR-AWJCGNBXSA-N |
| XLogP | 4.91 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|