C25H31F3O8 — CID 91024332
(5S)-10-hydroxy-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-13-(trifluoromethyl)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one (PubChem CID 91024332) has the molecular formula C25H31F3O8 and a molecular weight of 516.51 g/mol. Its IUPAC name is (5S)-10-hydroxy-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-13-(trifluoromethyl)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one.
| Compound Name | (5S)-10-hydroxy-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-13-(trifluoromethyl)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
|---|---|
| PubChem CID | 91024332 |
| Molecular Formula | C25H31F3O8 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | (5S)-10-hydroxy-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-13-(trifluoromethyl)-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
| SMILES | COCOc1cc(OC)cc2c1C(=O)OC(C)C(C(F)(F)F)C=CC(O)C1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C25H31F3O8/c1-14-17(25(26,27)28)9-10-18(29)22-19(35-24(2,3)36-22)8-6-7-15-11-16(32-5)12-20(33-13-31-4)21(15)23(30)34-14/h6-7,9-12,14,17-19,22,29H,8,13H2,1-5H3/t14?,17?,18?,19-,22?/m0/s1 |
| InChIKey | ZZJBHUWEGQOUQA-NCLVEQHPSA-N |
| XLogP | 4.26 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|