C24H29FO8 — CID 89025127
(2E,5S,11E)-11-fluoro-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaene-10,16-dione (PubChem CID 89025127) has the molecular formula C24H29FO8 and a molecular weight of 464.49 g/mol. Its IUPAC name is (2E,5S,11E)-11-fluoro-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaene-10,16-dione.
| Compound Name | (2E,5S,11E)-11-fluoro-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaene-10,16-dione |
|---|---|
| PubChem CID | 89025127 |
| Molecular Formula | C24H29FO8 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (2E,5S,11E)-11-fluoro-20-methoxy-18-(methoxymethoxy)-7,7,14-trimethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaene-10,16-dione |
| SMILES | COCOc1cc(OC)cc2c1C(=O)OC(C)C/C=C(/F)C(=O)C1OC(C)(C)O[C@H]1C/C=C/2 |
| InChI | InChI=1S/C24H29FO8/c1-14-9-10-17(25)21(26)22-18(32-24(2,3)33-22)8-6-7-15-11-16(29-5)12-19(30-13-28-4)20(15)23(27)31-14/h6-7,10-12,14,18,22H,8-9,13H2,1-5H3/b7-6+,17-10+/t14?,18-,22?/m0/s1 |
| InChIKey | DQLDEECRWPZMPL-LWVNMZDUSA-N |
| XLogP | 3.97 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|