C33H42O8 — CID 173470810
(5S,9R,11Z,13R,14S)-18-(methoxymethoxy)-20-[(4-methoxyphenyl)methoxy]-7,7,10,13,14-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one (PubChem CID 173470810) has the molecular formula C33H42O8 and a molecular weight of 566.69 g/mol. Its IUPAC name is (5S,9R,11Z,13R,14S)-18-(methoxymethoxy)-20-[(4-methoxyphenyl)methoxy]-7,7,10,13,14-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one.
| Compound Name | (5S,9R,11Z,13R,14S)-18-(methoxymethoxy)-20-[(4-methoxyphenyl)methoxy]-7,7,10,13,14-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
|---|---|
| PubChem CID | 173470810 |
| Molecular Formula | C33H42O8 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | (5S,9R,11Z,13R,14S)-18-(methoxymethoxy)-20-[(4-methoxyphenyl)methoxy]-7,7,10,13,14-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
| SMILES | COCOc1cc(OCc2ccc(OC)cc2)cc2c1C(=O)O[C@@H](C)[C@H](C)/C=C\C(C)[C@H]1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C33H42O8/c1-21-11-12-22(2)31-28(40-33(4,5)41-31)10-8-9-25-17-27(37-19-24-13-15-26(36-7)16-14-24)18-29(38-20-35-6)30(25)32(34)39-23(21)3/h8-9,11-18,21-23,28,31H,10,19-20H2,1-7H3/b9-8?,12-11-/t21-,22?,23+,28+,31-/m1/s1 |
| InChIKey | PGPQIWOTDLXOJB-XVEGLCNXSA-N |
| XLogP | 6.57 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|