C30H36O7 — CID 90925793
(5S,9R,13R,14S)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-20-phenyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one (PubChem CID 90925793) has the molecular formula C30H36O7 and a molecular weight of 508.61 g/mol. Its IUPAC name is (5S,9R,13R,14S)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-20-phenyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one.
| Compound Name | (5S,9R,13R,14S)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-20-phenyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
|---|---|
| PubChem CID | 90925793 |
| Molecular Formula | C30H36O7 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | (5S,9R,13R,14S)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-20-phenyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
| SMILES | COCOc1cc(-c2ccccc2)cc2c1C(=O)O[C@@H](C)[C@H](C)C=CC(O)[C@H]1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C30H36O7/c1-19-14-15-24(31)28-25(36-30(3,4)37-28)13-9-12-22-16-23(21-10-7-6-8-11-21)17-26(34-18-33-5)27(22)29(32)35-20(19)2/h6-12,14-17,19-20,24-25,28,31H,13,18H2,1-5H3/t19-,20+,24?,25+,28-/m1/s1 |
| InChIKey | SRPPILMXVHWOSX-KFONQTAPSA-N |
| XLogP | 5.37 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|