C24H31NO7 — CID 90802616
(5S)-20-methoxy-18-(methoxymethoxy)-7,7,13-trimethyl-6,8-dioxa-15-azatricyclo[15.4.0.05,9]henicosa-1(17),2,12,18,20-pentaene-10,16-dione (PubChem CID 90802616) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is (5S)-20-methoxy-18-(methoxymethoxy)-7,7,13-trimethyl-6,8-dioxa-15-azatricyclo[15.4.0.05,9]henicosa-1(17),2,12,18,20-pentaene-10,16-dione.
| Compound Name | (5S)-20-methoxy-18-(methoxymethoxy)-7,7,13-trimethyl-6,8-dioxa-15-azatricyclo[15.4.0.05,9]henicosa-1(17),2,12,18,20-pentaene-10,16-dione |
|---|---|
| PubChem CID | 90802616 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (5S)-20-methoxy-18-(methoxymethoxy)-7,7,13-trimethyl-6,8-dioxa-15-azatricyclo[15.4.0.05,9]henicosa-1(17),2,12,18,20-pentaene-10,16-dione |
| SMILES | COCOc1cc(OC)cc2c1C(=O)NCC(C)=CCC(=O)C1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C24H31NO7/c1-15-9-10-18(26)22-19(31-24(2,3)32-22)8-6-7-16-11-17(29-5)12-20(30-14-28-4)21(16)23(27)25-13-15/h6-7,9,11-12,19,22H,8,10,13-14H2,1-5H3,(H,25,27)/t19-,22?/m0/s1 |
| InChIKey | DPGSVYOSOLCUMN-YDNXMHBPSA-N |
| XLogP | 3.25 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|