C24H30F2O6 — CID 58304869
(2E,5S,9R,11Z,13R,14S)-20-(difluoromethoxy)-10-hydroxy-7,7,13,14,18-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one (PubChem CID 58304869) has the molecular formula C24H30F2O6 and a molecular weight of 452.49 g/mol. Its IUPAC name is (2E,5S,9R,11Z,13R,14S)-20-(difluoromethoxy)-10-hydroxy-7,7,13,14,18-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one.
| Compound Name | (2E,5S,9R,11Z,13R,14S)-20-(difluoromethoxy)-10-hydroxy-7,7,13,14,18-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
|---|---|
| PubChem CID | 58304869 |
| Molecular Formula | C24H30F2O6 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (2E,5S,9R,11Z,13R,14S)-20-(difluoromethoxy)-10-hydroxy-7,7,13,14,18-pentamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-16-one |
| SMILES | Cc1cc(OC(F)F)cc2c1C(=O)O[C@@H](C)[C@H](C)/C=C\C(O)[C@H]1OC(C)(C)O[C@H]1C/C=C/2 |
| InChI | InChI=1S/C24H30F2O6/c1-13-9-10-18(27)21-19(31-24(4,5)32-21)8-6-7-16-12-17(30-23(25)26)11-14(2)20(16)22(28)29-15(13)3/h6-7,9-13,15,18-19,21,23,27H,8H2,1-5H3/b7-6+,10-9-/t13-,15+,18?,19+,21-/m1/s1 |
| InChIKey | AQRDWOSDPQZVMD-LVTRBEPQSA-N |
| XLogP | 4.63 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|