C26H34O7 — CID 58750389
(6R,10S,12E,15S)-21-methoxy-19-(methoxymethoxy)-8,8,15-trimethyl-7,9-dioxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraene-11,17-dione (PubChem CID 58750389) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is (6R,10S,12E,15S)-21-methoxy-19-(methoxymethoxy)-8,8,15-trimethyl-7,9-dioxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraene-11,17-dione.
| Compound Name | (6R,10S,12E,15S)-21-methoxy-19-(methoxymethoxy)-8,8,15-trimethyl-7,9-dioxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraene-11,17-dione |
|---|---|
| PubChem CID | 58750389 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (6R,10S,12E,15S)-21-methoxy-19-(methoxymethoxy)-8,8,15-trimethyl-7,9-dioxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraene-11,17-dione |
| SMILES | COCOc1cc(OC)cc2c1C(=O)C[C@@H](C)C/C=C/C(=O)[C@H]1OC(C)(C)O[C@@H]1CC1CC21 |
| InChI | InChI=1S/C26H34O7/c1-15-7-6-8-20(27)25-23(32-26(2,3)33-25)11-16-10-18(16)19-12-17(30-5)13-22(31-14-29-4)24(19)21(28)9-15/h6,8,12-13,15-16,18,23,25H,7,9-11,14H2,1-5H3/b8-6+/t15-,16?,18?,23+,25+/m0/s1 |
| InChIKey | UOTYAUOAFKIFBT-IKPKBZRRSA-N |
| XLogP | 4.43 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|