C18H24O4 — CID 71600221
(4R,7Z)-14,16-dimethoxy-4-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),7,13,15-tetraen-2-one (PubChem CID 71600221) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (4R,7Z)-14,16-dimethoxy-4-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),7,13,15-tetraen-2-one.
| Compound Name | (4R,7Z)-14,16-dimethoxy-4-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),7,13,15-tetraen-2-one |
|---|---|
| PubChem CID | 71600221 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (4R,7Z)-14,16-dimethoxy-4-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),7,13,15-tetraen-2-one |
| SMILES | COc1cc2c(c(OC)c1)C(=O)O[C@H](C)CC/C=C\CCC2 |
| InChI | InChI=1S/C18H24O4/c1-13-9-7-5-4-6-8-10-14-11-15(20-2)12-16(21-3)17(14)18(19)22-13/h4-5,11-13H,6-10H2,1-3H3/b5-4-/t13-/m1/s1 |
| InChIKey | OEJFGTTWULMJIK-DSYXLKISSA-N |
| XLogP | 3.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|