C25H32O6 — CID 123187896
carbon dioxide;(2E,5S,9R,11Z,14S)-7,7,10,14,18,21-hexamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaen-16-one (PubChem CID 123187896) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is carbon dioxide;(2E,5S,9R,11Z,14S)-7,7,10,14,18,21-hexamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaen-16-one.
| Compound Name | carbon dioxide;(2E,5S,9R,11Z,14S)-7,7,10,14,18,21-hexamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaen-16-one |
|---|---|
| PubChem CID | 123187896 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | carbon dioxide;(2E,5S,9R,11Z,14S)-7,7,10,14,18,21-hexamethyl-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(21),2,11,17,19-pentaen-16-one |
| SMILES | Cc1ccc(C)c2c1/C=C/C[C@@H]1OC(C)(C)O[C@@H]1C(C)/C=C\C[C@H](C)OC2=O.O=C=O |
| InChI | InChI=1S/C24H32O4.CO2/c1-15-13-14-16(2)21-19(15)11-8-12-20-22(28-24(5,6)27-20)17(3)9-7-10-18(4)26-23(21)25;2-1-3/h7-9,11,13-14,17-18,20,22H,10,12H2,1-6H3;/b9-7-,11-8+;/t17?,18-,20-,22+;/m0./s1 |
| InChIKey | DEFONHXPHGMTDG-RVTPNCDZSA-N |
| XLogP | 4.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|