C31H36O7 — CID 59467121
[(6R,10S,12Z,15S)-21-methoxy-8,8,15,19-tetramethyl-17-oxo-7,9,16-trioxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraen-11-yl] benzoate (PubChem CID 59467121) has the molecular formula C31H36O7 and a molecular weight of 520.62 g/mol. Its IUPAC name is [(6R,10S,12Z,15S)-21-methoxy-8,8,15,19-tetramethyl-17-oxo-7,9,16-trioxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraen-11-yl] benzoate.
| Compound Name | [(6R,10S,12Z,15S)-21-methoxy-8,8,15,19-tetramethyl-17-oxo-7,9,16-trioxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraen-11-yl] benzoate |
|---|---|
| PubChem CID | 59467121 |
| Molecular Formula | C31H36O7 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | [(6R,10S,12Z,15S)-21-methoxy-8,8,15,19-tetramethyl-17-oxo-7,9,16-trioxatetracyclo[16.4.0.02,4.06,10]docosa-1(18),12,19,21-tetraen-11-yl] benzoate |
| SMILES | COc1cc(C)c2c(c1)C1CC1C[C@H]1OC(C)(C)O[C@@H]1C(OC(=O)c1ccccc1)/C=C\C[C@H](C)OC2=O |
| InChI | InChI=1S/C31H36O7/c1-18-14-22(34-5)17-24-23-15-21(23)16-26-28(38-31(3,4)37-26)25(36-29(32)20-11-7-6-8-12-20)13-9-10-19(2)35-30(33)27(18)24/h6-9,11-14,17,19,21,23,25-26,28H,10,15-16H2,1-5H3/b13-9-/t19-,21?,23?,25?,26+,28+/m0/s1 |
| InChIKey | LQUACVKPMSTHNL-DYTPCCAFSA-N |
| XLogP | 5.75 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|