C25H30O5 — CID 58304343
(4S,8R,9Z,12S,16S,18E)-14,14,22,24-tetramethyl-3,13,15-trioxatetracyclo[18.4.0.04,8.012,16]tetracosa-1(24),9,18,20,22-pentaene-2,11-dione (PubChem CID 58304343) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is (4S,8R,9Z,12S,16S,18E)-14,14,22,24-tetramethyl-3,13,15-trioxatetracyclo[18.4.0.04,8.012,16]tetracosa-1(24),9,18,20,22-pentaene-2,11-dione.
| Compound Name | (4S,8R,9Z,12S,16S,18E)-14,14,22,24-tetramethyl-3,13,15-trioxatetracyclo[18.4.0.04,8.012,16]tetracosa-1(24),9,18,20,22-pentaene-2,11-dione |
|---|---|
| PubChem CID | 58304343 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (4S,8R,9Z,12S,16S,18E)-14,14,22,24-tetramethyl-3,13,15-trioxatetracyclo[18.4.0.04,8.012,16]tetracosa-1(24),9,18,20,22-pentaene-2,11-dione |
| SMILES | Cc1cc(C)c2c(c1)/C=C/C[C@@H]1OC(C)(C)O[C@@H]1C(=O)/C=C\[C@H]1CCC[C@@H]1OC2=O |
| InChI | InChI=1S/C25H30O5/c1-15-13-16(2)22-18(14-15)8-6-10-21-23(30-25(3,4)29-21)19(26)12-11-17-7-5-9-20(17)28-24(22)27/h6,8,11-14,17,20-21,23H,5,7,9-10H2,1-4H3/b8-6+,12-11-/t17-,20+,21+,23-/m1/s1 |
| InChIKey | KWWRUGZHEXZDDN-XOOQCFBSSA-N |
| XLogP | 4.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |