C13H18O2 — CID 116864087
3-(2-methoxy-4,6-dimethylphenyl)-2,2-dimethyloxirane (PubChem CID 116864087) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 3-(2-methoxy-4,6-dimethylphenyl)-2,2-dimethyloxirane.
| Compound Name | 3-(2-methoxy-4,6-dimethylphenyl)-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 116864087 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-(2-methoxy-4,6-dimethylphenyl)-2,2-dimethyloxirane |
| SMILES | COc1cc(C)cc(C)c1C1OC1(C)C |
| InChI | InChI=1S/C13H18O2/c1-8-6-9(2)11(10(7-8)14-5)12-13(3,4)15-12/h6-7,12H,1-5H3 |
| InChIKey | JKQIXTJHDQQDHU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|