C21H27ClN2O5 — CID 91245159
3-(2-chloro-4,6-dimethylphenyl)-8-methoxy-1-(oxolan-2-yloxy)-1,8-diazaspiro[4.5]decane-2,4-dione (PubChem CID 91245159) has the molecular formula C21H27ClN2O5 and a molecular weight of 422.91 g/mol. Its IUPAC name is 3-(2-chloro-4,6-dimethylphenyl)-8-methoxy-1-(oxolan-2-yloxy)-1,8-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(2-chloro-4,6-dimethylphenyl)-8-methoxy-1-(oxolan-2-yloxy)-1,8-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91245159 |
| Molecular Formula | C21H27ClN2O5 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-(2-chloro-4,6-dimethylphenyl)-8-methoxy-1-(oxolan-2-yloxy)-1,8-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CON1CCC2(CC1)C(=O)C(c1c(C)cc(C)cc1Cl)C(=O)N2OC1CCCO1 |
| InChI | InChI=1S/C21H27ClN2O5/c1-13-11-14(2)17(15(22)12-13)18-19(25)21(6-8-23(27-3)9-7-21)24(20(18)26)29-16-5-4-10-28-16/h11-12,16,18H,4-10H2,1-3H3 |
| InChIKey | NMMCIURLUBHSHZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|