C20H27BrN2O5 — CID 91125089
3-(4-bromo-2,6-dimethylphenyl)-8-methoxy-1-(2-methoxyethoxy)-1,8-diazaspiro[4.5]decane-2,4-dione (PubChem CID 91125089) has the molecular formula C20H27BrN2O5 and a molecular weight of 455.35 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dimethylphenyl)-8-methoxy-1-(2-methoxyethoxy)-1,8-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(4-bromo-2,6-dimethylphenyl)-8-methoxy-1-(2-methoxyethoxy)-1,8-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91125089 |
| Molecular Formula | C20H27BrN2O5 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 3-(4-bromo-2,6-dimethylphenyl)-8-methoxy-1-(2-methoxyethoxy)-1,8-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCON1C(=O)C(c2c(C)cc(Br)cc2C)C(=O)C12CCN(OC)CC2 |
| InChI | InChI=1S/C20H27BrN2O5/c1-13-11-15(21)12-14(2)16(13)17-18(24)20(5-7-22(27-4)8-6-20)23(19(17)25)28-10-9-26-3/h11-12,17H,5-10H2,1-4H3 |
| InChIKey | WWJMDWJGRJCERH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|