C26H40N2O4 — CID 123876725
8-(2,4-dimethylhexoxy)-1-methoxy-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione (PubChem CID 123876725) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is 8-(2,4-dimethylhexoxy)-1-methoxy-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(2,4-dimethylhexoxy)-1-methoxy-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 123876725 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 8-(2,4-dimethylhexoxy)-1-methoxy-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCC(C)CC(C)CON1CCC2(CC1)C(=O)C(c1c(C)cc(C)cc1C)C(=O)N2OC |
| InChI | InChI=1S/C26H40N2O4/c1-8-17(2)13-19(4)16-32-27-11-9-26(10-12-27)24(29)23(25(30)28(26)31-7)22-20(5)14-18(3)15-21(22)6/h14-15,17,19,23H,8-13,16H2,1-7H3 |
| InChIKey | JPGZUTWETOQQME-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|