C24H36N2O4 — CID 123877276
1-methoxy-8-(2-methylpentoxy)-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione (PubChem CID 123877276) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is 1-methoxy-8-(2-methylpentoxy)-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-methoxy-8-(2-methylpentoxy)-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 123877276 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 1-methoxy-8-(2-methylpentoxy)-3-(2,4,6-trimethylphenyl)-1,8-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCCC(C)CON1CCC2(CC1)C(=O)C(c1c(C)cc(C)cc1C)C(=O)N2OC |
| InChI | InChI=1S/C24H36N2O4/c1-7-8-16(2)15-30-25-11-9-24(10-12-25)22(27)21(23(28)26(24)29-6)20-18(4)13-17(3)14-19(20)5/h13-14,16,21H,7-12,15H2,1-6H3 |
| InChIKey | CQPLDGCOYPWPLD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|