C25H29ClN2O5 — CID 91348064
3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-8-methoxy-1-(methoxymethoxy)-1,8-diazaspiro[4.5]decane-2,4-dione (PubChem CID 91348064) has the molecular formula C25H29ClN2O5 and a molecular weight of 472.97 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-8-methoxy-1-(methoxymethoxy)-1,8-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-8-methoxy-1-(methoxymethoxy)-1,8-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91348064 |
| Molecular Formula | C25H29ClN2O5 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-2,6-dimethylphenyl]-8-methoxy-1-(methoxymethoxy)-1,8-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COCON1C(=O)C(c2c(C)cc(-c3ccc(Cl)cc3)cc2C)C(=O)C12CCN(OC)CC2 |
| InChI | InChI=1S/C25H29ClN2O5/c1-16-13-19(18-5-7-20(26)8-6-18)14-17(2)21(16)22-23(29)25(9-11-27(32-4)12-10-25)28(24(22)30)33-15-31-3/h5-8,13-14,22H,9-12,15H2,1-4H3 |
| InChIKey | XCAJDMXNXQJNPG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|