C19H25ClN2O5 — CID 58428060
3-(4-chloro-2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-(methoxymethoxy)-1,8-diazaspiro[4.5]dec-3-en-2-one (PubChem CID 58428060) has the molecular formula C19H25ClN2O5 and a molecular weight of 396.87 g/mol. Its IUPAC name is 3-(4-chloro-2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-(methoxymethoxy)-1,8-diazaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-(4-chloro-2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-(methoxymethoxy)-1,8-diazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 58428060 |
| Molecular Formula | C19H25ClN2O5 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-(4-chloro-2,5-dimethylphenyl)-4-hydroxy-8-methoxy-1-(methoxymethoxy)-1,8-diazaspiro[4.5]dec-3-en-2-one |
| SMILES | COCON1C(=O)C(c2cc(C)c(Cl)cc2C)=C(O)C12CCN(OC)CC2 |
| InChI | InChI=1S/C19H25ClN2O5/c1-12-10-15(20)13(2)9-14(12)16-17(23)19(5-7-21(26-4)8-6-19)22(18(16)24)27-11-25-3/h9-10,23H,5-8,11H2,1-4H3 |
| InChIKey | OVDUQMJKXKASCJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|