C19H23Cl2NO3 — CID 90688550
3-(2,4-dichloro-6-methylphenyl)-8-ethoxy-8-methyl-1-azaspiro[4.5]decane-2,4-dione (PubChem CID 90688550) has the molecular formula C19H23Cl2NO3 and a molecular weight of 384.30 g/mol. Its IUPAC name is 3-(2,4-dichloro-6-methylphenyl)-8-ethoxy-8-methyl-1-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(2,4-dichloro-6-methylphenyl)-8-ethoxy-8-methyl-1-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 90688550 |
| Molecular Formula | C19H23Cl2NO3 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-(2,4-dichloro-6-methylphenyl)-8-ethoxy-8-methyl-1-azaspiro[4.5]decane-2,4-dione |
| SMILES | CCOC1(C)CCC2(CC1)NC(=O)C(c1c(C)cc(Cl)cc1Cl)C2=O |
| InChI | InChI=1S/C19H23Cl2NO3/c1-4-25-18(3)5-7-19(8-6-18)16(23)15(17(24)22-19)14-11(2)9-12(20)10-13(14)21/h9-10,15H,4-8H2,1-3H3,(H,22,24) |
| InChIKey | GVWIYTKTTCYSFQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|