C18H20Cl2O2 — CID 91175314
2-(2,4-dichloro-6-methylphenyl)-5,6-dimethyl-3a,4,5,6,7,7a-hexahydroindene-1,3-dione (PubChem CID 91175314) has the molecular formula C18H20Cl2O2 and a molecular weight of 339.26 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-methylphenyl)-5,6-dimethyl-3a,4,5,6,7,7a-hexahydroindene-1,3-dione.
| Compound Name | 2-(2,4-dichloro-6-methylphenyl)-5,6-dimethyl-3a,4,5,6,7,7a-hexahydroindene-1,3-dione |
|---|---|
| PubChem CID | 91175314 |
| Molecular Formula | C18H20Cl2O2 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 2-(2,4-dichloro-6-methylphenyl)-5,6-dimethyl-3a,4,5,6,7,7a-hexahydroindene-1,3-dione |
| SMILES | Cc1cc(Cl)cc(Cl)c1C1C(=O)C2CC(C)C(C)CC2C1=O |
| InChI | InChI=1S/C18H20Cl2O2/c1-8-5-12-13(6-9(8)2)18(22)16(17(12)21)15-10(3)4-11(19)7-14(15)20/h4,7-9,12-13,16H,5-6H2,1-3H3 |
| InChIKey | DHHRCLHIEQENKJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|