C21H18ClFO2 — CID 90927481
3-[5-(3-chloro-4-fluorophenyl)-2-methylphenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 90927481) has the molecular formula C21H18ClFO2 and a molecular weight of 356.82 g/mol. Its IUPAC name is 3-[5-(3-chloro-4-fluorophenyl)-2-methylphenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[5-(3-chloro-4-fluorophenyl)-2-methylphenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 90927481 |
| Molecular Formula | C21H18ClFO2 |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3-[5-(3-chloro-4-fluorophenyl)-2-methylphenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1ccc(-c2ccc(F)c(Cl)c2)cc1C1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C21H18ClFO2/c1-11-2-3-12(13-6-7-18(23)17(22)10-13)9-16(11)19-20(24)14-4-5-15(8-14)21(19)25/h2-3,6-7,9-10,14-15,19H,4-5,8H2,1H3 |
| InChIKey | JGZUNOVFCQMLBW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|