C22H20ClFO2 — CID 91024110
(1R,5S)-3-[5-(3-chloro-4-fluorophenyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 91024110) has the molecular formula C22H20ClFO2 and a molecular weight of 370.85 g/mol. Its IUPAC name is (1R,5S)-3-[5-(3-chloro-4-fluorophenyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-3-[5-(3-chloro-4-fluorophenyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91024110 |
| Molecular Formula | C22H20ClFO2 |
| Molecular Weight | 370.85 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (1R,5S)-3-[5-(3-chloro-4-fluorophenyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(-c2ccc(F)c(Cl)c2)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C22H20ClFO2/c1-2-12-3-4-13(14-7-8-19(24)18(23)11-14)10-17(12)20-21(25)15-5-6-16(9-15)22(20)26/h3-4,7-8,10-11,15-16,20H,2,5-6,9H2,1H3/t15-,16+,20? |
| InChIKey | QMIQPYJCCYTALH-NYTJIUQPSA-N |
| XLogP | 5.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.85 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|