C23H20ClNO2 — CID 90923004
2-chloro-5-[3-[(1S,5R)-2,4-dioxo-3-bicyclo[3.2.1]octanyl]-4-ethylphenyl]benzonitrile (PubChem CID 90923004) has the molecular formula C23H20ClNO2 and a molecular weight of 377.87 g/mol. Its IUPAC name is 2-chloro-5-[3-[(1S,5R)-2,4-dioxo-3-bicyclo[3.2.1]octanyl]-4-ethylphenyl]benzonitrile.
| Compound Name | 2-chloro-5-[3-[(1S,5R)-2,4-dioxo-3-bicyclo[3.2.1]octanyl]-4-ethylphenyl]benzonitrile |
|---|---|
| PubChem CID | 90923004 |
| Molecular Formula | C23H20ClNO2 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-chloro-5-[3-[(1S,5R)-2,4-dioxo-3-bicyclo[3.2.1]octanyl]-4-ethylphenyl]benzonitrile |
| SMILES | CCc1ccc(-c2ccc(Cl)c(C#N)c2)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C23H20ClNO2/c1-2-13-3-4-15(14-7-8-20(24)18(9-14)12-25)11-19(13)21-22(26)16-5-6-17(10-16)23(21)27/h3-4,7-9,11,16-17,21H,2,5-6,10H2,1H3/t16-,17+,21? |
| InChIKey | NZSSBGCNDAQMGC-QRTHJKPMSA-N |
| XLogP | 5.09 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|