C22H21FO3 — CID 91080082
3-[2-ethyl-5-(4-fluorophenoxy)phenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 91080082) has the molecular formula C22H21FO3 and a molecular weight of 352.41 g/mol. Its IUPAC name is 3-[2-ethyl-5-(4-fluorophenoxy)phenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[2-ethyl-5-(4-fluorophenoxy)phenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91080082 |
| Molecular Formula | C22H21FO3 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-[2-ethyl-5-(4-fluorophenoxy)phenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(Oc2ccc(F)cc2)cc1C1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C22H21FO3/c1-2-13-5-8-18(26-17-9-6-16(23)7-10-17)12-19(13)20-21(24)14-3-4-15(11-14)22(20)25/h5-10,12,14-15,20H,2-4,11H2,1H3 |
| InChIKey | FKOHEKJMRQQQQM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|