C16H19BO5 — CID 142783340
[3-(2,4-dioxo-3-bicyclo[3.2.1]octanyl)-4-ethylphenoxy]boronic acid (PubChem CID 142783340) has the molecular formula C16H19BO5 and a molecular weight of 302.13 g/mol. Its IUPAC name is [3-(2,4-dioxo-3-bicyclo[3.2.1]octanyl)-4-ethylphenoxy]boronic acid.
| Compound Name | [3-(2,4-dioxo-3-bicyclo[3.2.1]octanyl)-4-ethylphenoxy]boronic acid |
|---|---|
| PubChem CID | 142783340 |
| Molecular Formula | C16H19BO5 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [3-(2,4-dioxo-3-bicyclo[3.2.1]octanyl)-4-ethylphenoxy]boronic acid |
| SMILES | CCc1ccc(OB(O)O)cc1C1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C16H19BO5/c1-2-9-5-6-12(22-17(20)21)8-13(9)14-15(18)10-3-4-11(7-10)16(14)19/h5-6,8,10-11,14,20-21H,2-4,7H2,1H3 |
| InChIKey | RYGRURUTPBKJQY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|