C23H21F3O4 — CID 123605455
(1R,5S)-3-[2-ethyl-5-[4-(trifluoromethoxy)phenoxy]phenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 123605455) has the molecular formula C23H21F3O4 and a molecular weight of 418.41 g/mol. Its IUPAC name is (1R,5S)-3-[2-ethyl-5-[4-(trifluoromethoxy)phenoxy]phenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-3-[2-ethyl-5-[4-(trifluoromethoxy)phenoxy]phenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 123605455 |
| Molecular Formula | C23H21F3O4 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (1R,5S)-3-[2-ethyl-5-[4-(trifluoromethoxy)phenoxy]phenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C23H21F3O4/c1-2-13-5-6-18(29-16-7-9-17(10-8-16)30-23(24,25)26)12-19(13)20-21(27)14-3-4-15(11-14)22(20)28/h5-10,12,14-15,20H,2-4,11H2,1H3/t14-,15+,20? |
| InChIKey | OVZQNOYDMDENPM-DBIVSCPCSA-N |
| XLogP | 5.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|