C24H22Cl2O3 — CID 91418250
4-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]tricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 91418250) has the molecular formula C24H22Cl2O3 and a molecular weight of 429.34 g/mol. Its IUPAC name is 4-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]tricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]tricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 91418250 |
| Molecular Formula | C24H22Cl2O3 |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 4-[5-(2,4-dichlorophenoxy)-2-ethylphenyl]tricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1ccc(Oc2ccc(Cl)cc2Cl)cc1C1C(=O)C2C3CCC(C3)C2C1=O |
| InChI | InChI=1S/C24H22Cl2O3/c1-2-12-5-7-16(29-19-8-6-15(25)10-18(19)26)11-17(12)22-23(27)20-13-3-4-14(9-13)21(20)24(22)28/h5-8,10-11,13-14,20-22H,2-4,9H2,1H3 |
| InChIKey | KKKBQWJZUSOIOC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|